About (E)-3-(4-bromophenyl)-N,N-dimethyl-3-phenylprop-2-en-1-amine;hydrochloride
(E)-3-(4-bromophenyl)-N,N-dimethyl-3-phenylprop-2-en-1-amine;hydrochloride (PubChem CID 6437583) has the molecular formula C17H19BrClN
and a molecular weight of 352.70 g/mol. Its IUPAC name is (E)-3-(4-bromophenyl)-N,N-dimethyl-3-phenylprop-2-en-1-amine;hydrochloride.
Molecular Properties
| Compound Name | (E)-3-(4-bromophenyl)-N,N-dimethyl-3-phenylprop-2-en-1-amine;hydrochloride |
| PubChem CID | 6437583 |
| Molecular Formula | C17H19BrClN |
| Molecular Weight | 352.70 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | (E)-3-(4-bromophenyl)-N,N-dimethyl-3-phenylprop-2-en-1-amine;hydrochloride |
| SMILES | CN(C)C/C=C(\c1ccccc1)c1ccc(Br)cc1.Cl |
| InChI | InChI=1S/C17H18BrN.ClH/c1-19(2)13-12-17(14-6-4-3-5-7-14)15-8-10-16(18)11-9-15;/h3-12H,13H2,1-2H3;1H/b17-12+; |
| InChIKey | BHECBLIRYXAYDD-KCUXUEJTSA-N |
| XLogP | 4.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.70 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-3-(4-bromophenyl)-N,N-dimethyl-3-phenylprop-2-en-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(4-bromophenyl)-N,N-dimethyl-3-phenylprop-2-en-1-amine;hydrochloride?
The IUPAC name of (E)-3-(4-bromophenyl)-N,N-dimethyl-3-phenylprop-2-en-1-amine;hydrochloride (CID 6437583) is (E)-3-(4-bromophenyl)-N,N-dimethyl-3-phenylprop-2-en-1-amine;hydrochloride.
What is the SMILES notation for (E)-3-(4-bromophenyl)-N,N-dimethyl-3-phenylprop-2-en-1-amine;hydrochloride?
The canonical SMILES for (E)-3-(4-bromophenyl)-N,N-dimethyl-3-phenylprop-2-en-1-amine;hydrochloride is CN(C)C/C=C(\c1ccccc1)c1ccc(Br)cc1.Cl.
What is the InChIKey of (E)-3-(4-bromophenyl)-N,N-dimethyl-3-phenylprop-2-en-1-amine;hydrochloride?
The InChIKey is BHECBLIRYXAYDD-KCUXUEJTSA-N. The full InChI is InChI=1S/C17H18BrN.ClH/c1-19(2)13-12-17(14-6-4-3-5-7-14)15-8-10-16(18)11-9-15;/h3-12H,13H2,1-2H3;1H/b17-12+;.
What are the key properties of (E)-3-(4-bromophenyl)-N,N-dimethyl-3-phenylprop-2-en-1-amine;hydrochloride?
(E)-3-(4-bromophenyl)-N,N-dimethyl-3-phenylprop-2-en-1-amine;hydrochloride has a molecular weight of 352.70 g/mol, XLogP of 4.86, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(4-bromophenyl)-N,N-dimethyl-3-phenylprop-2-en-1-amine;hydrochloride is sourced from PubChem (CID 6437583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).