About (5-methyl-2-propan-2-ylcyclohexyl) (Z)-octadec-9-enoate
(5-methyl-2-propan-2-ylcyclohexyl) (Z)-octadec-9-enoate (PubChem CID 6437587) has the molecular formula C28H52O2
and a molecular weight of 420.72 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) (Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) (Z)-octadec-9-enoate |
| PubChem CID | 6437587 |
| Molecular Formula | C28H52O2 |
| Molecular Weight | 420.72 g/mol |
| Exact Mass | 420.40 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C28H52O2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-28(29)30-27-23-25(4)21-22-26(27)24(2)3/h12-13,24-27H,5-11,14-23H2,1-4H3/b13-12- |
| InChIKey | KSXDYSUCRAXJBC-SEYXRHQNSA-N |
| XLogP | 9.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.72 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5-methyl-2-propan-2-ylcyclohexyl) (Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) (Z)-octadec-9-enoate?
The IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) (Z)-octadec-9-enoate (CID 6437587) is (5-methyl-2-propan-2-ylcyclohexyl) (Z)-octadec-9-enoate.
What is the SMILES notation for (5-methyl-2-propan-2-ylcyclohexyl) (Z)-octadec-9-enoate?
The canonical SMILES for (5-methyl-2-propan-2-ylcyclohexyl) (Z)-octadec-9-enoate is CCCCCCCC/C=C\CCCCCCCC(=O)OC1CC(C)CCC1C(C)C.
What is the InChIKey of (5-methyl-2-propan-2-ylcyclohexyl) (Z)-octadec-9-enoate?
The InChIKey is KSXDYSUCRAXJBC-SEYXRHQNSA-N. The full InChI is InChI=1S/C28H52O2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-28(29)30-27-23-25(4)21-22-26(27)24(2)3/h12-13,24-27H,5-11,14-23H2,1-4H3/b13-12-.
What are the key properties of (5-methyl-2-propan-2-ylcyclohexyl) (Z)-octadec-9-enoate?
(5-methyl-2-propan-2-ylcyclohexyl) (Z)-octadec-9-enoate has a molecular weight of 420.72 g/mol, XLogP of 9.03, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-propan-2-ylcyclohexyl) (Z)-octadec-9-enoate is sourced from PubChem (CID 6437587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).