C10H15NO — CID 6437613
(NZ)-N-[(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)methylidene]hydroxylamine (PubChem CID 6437613) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (NZ)-N-[(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 6437613 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (NZ)-N-[(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)methylidene]hydroxylamine |
| SMILES | CC1=C(/C=N\O)C(C)(C)CC=C1 |
| InChI | InChI=1S/C10H15NO/c1-8-5-4-6-10(2,3)9(8)7-11-12/h4-5,7,12H,6H2,1-3H3/b11-7- |
| InChIKey | POYDEASPSJCUBW-XFFZJAGNSA-N |
| XLogP | 2.75 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|