C16H28O2 — CID 6437622
(5E,7E)-3,8,12-trimethyltrideca-5,7,11-triene-3,4-diol (PubChem CID 6437622) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (5E,7E)-3,8,12-trimethyltrideca-5,7,11-triene-3,4-diol.
| Compound Name | (5E,7E)-3,8,12-trimethyltrideca-5,7,11-triene-3,4-diol |
|---|---|
| PubChem CID | 6437622 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (5E,7E)-3,8,12-trimethyltrideca-5,7,11-triene-3,4-diol |
| SMILES | CCC(C)(O)C(O)/C=C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C16H28O2/c1-6-16(5,18)15(17)12-8-11-14(4)10-7-9-13(2)3/h8-9,11-12,15,17-18H,6-7,10H2,1-5H3/b12-8+,14-11+ |
| InChIKey | LYXITZQJPFABBF-ZZAMHKPASA-N |
| XLogP | 3.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|