C30H60 — CID 6437646
(E)-2,6,10,15,19,23-hexamethyltetracos-7-ene (PubChem CID 6437646) has the molecular formula C30H60 and a molecular weight of 420.81 g/mol. Its IUPAC name is (E)-2,6,10,15,19,23-hexamethyltetracos-7-ene.
| Compound Name | (E)-2,6,10,15,19,23-hexamethyltetracos-7-ene |
|---|---|
| PubChem CID | 6437646 |
| Molecular Formula | C30H60 |
| Molecular Weight | 420.81 g/mol |
| Exact Mass | 420.47 |
| IUPAC Name | (E)-2,6,10,15,19,23-hexamethyltetracos-7-ene |
| SMILES | CC(C)CCCC(C)/C=C/CC(C)CCCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C30H60/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4/h13,23,25-30H,9-12,14-22,24H2,1-8H3/b23-13+ |
| InChIKey | WTFIBNFIISRGHJ-YDZHTSKRSA-N |
| XLogP | 10.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.81 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|