C17H18N4O6 — CID 6437666
5-[(E)-5-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)pent-3-enylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 6437666) has the molecular formula C17H18N4O6 and a molecular weight of 374.35 g/mol. Its IUPAC name is 5-[(E)-5-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)pent-3-enylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(E)-5-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)pent-3-enylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 6437666 |
| Molecular Formula | C17H18N4O6 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 5-[(E)-5-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)pent-3-enylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(=C/C=C/CC=C2C(=O)N(C)C(=O)N(C)C2=O)C(=O)N(C)C1=O |
| InChI | InChI=1S/C17H18N4O6/c1-18-12(22)10(13(23)19(2)16(18)26)8-6-5-7-9-11-14(24)20(3)17(27)21(4)15(11)25/h5-6,8-9H,7H2,1-4H3/b6-5+ |
| InChIKey | VUKLGXZGBALJRY-AATRIKPKSA-N |
| XLogP | -0.11 |
| TPSA | 115.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|