C61H108O6S3Sn — CID 6437700
2-[methyl-bis[2-[(9E,12E)-octadeca-9,12-dienoyl]oxyethylsulfanyl]stannyl]sulfanylethyl (9E,12E)-octadeca-9,12-dienoate (PubChem CID 6437700) has the molecular formula C61H108O6S3Sn and a molecular weight of 1152.44 g/mol. Its IUPAC name is 2-[methyl-bis[2-[(9E,12E)-octadeca-9,12-dienoyl]oxyethylsulfanyl]stannyl]sulfanylethyl (9E,12E)-octadeca-9,12-dienoate.
| Compound Name | 2-[methyl-bis[2-[(9E,12E)-octadeca-9,12-dienoyl]oxyethylsulfanyl]stannyl]sulfanylethyl (9E,12E)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 6437700 |
| Molecular Formula | C61H108O6S3Sn |
| Molecular Weight | 1152.44 g/mol |
| Exact Mass | 1152.63 |
| IUPAC Name | 2-[methyl-bis[2-[(9E,12E)-octadeca-9,12-dienoyl]oxyethylsulfanyl]stannyl]sulfanylethyl (9E,12E)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)OCCS[Sn](C)(SCCOC(=O)CCCCCCC/C=C/C/C=C/CCCCC)SCCOC(=O)CCCCCCC/C=C/C/C=C/CCCCC |
| InChI | InChI=1S/3C20H36O2S.CH3.Sn/c3*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(21)22-18-19-23;;/h3*6-7,9-10,23H,2-5,8,11-19H2,1H3;1H3;/q;;;;+3/p-3/b3*7-6+,10-9+;; |
| InChIKey | UGRICMDEZILJEC-QUNLTARISA-K |
| XLogP | 19.82 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1152.44 |
| LogP ≤ 5 | 19.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|