About 3,7-dimethyloct-6-enyl (E)-3-phenylprop-2-enoate
3,7-dimethyloct-6-enyl (E)-3-phenylprop-2-enoate (PubChem CID 6437720) has the molecular formula C19H26O2
and a molecular weight of 286.42 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl (E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | 3,7-dimethyloct-6-enyl (E)-3-phenylprop-2-enoate |
| PubChem CID | 6437720 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 3,7-dimethyloct-6-enyl (E)-3-phenylprop-2-enoate |
| SMILES | CC(C)=CCCC(C)CCOC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H26O2/c1-16(2)8-7-9-17(3)14-15-21-19(20)13-12-18-10-5-4-6-11-18/h4-6,8,10-13,17H,7,9,14-15H2,1-3H3/b13-12+ |
| InChIKey | KMXKQELDKDGFRN-OUKQBFOZSA-N |
| XLogP | 5.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyloct-6-enyl (E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyloct-6-enyl (E)-3-phenylprop-2-enoate?
The IUPAC name of 3,7-dimethyloct-6-enyl (E)-3-phenylprop-2-enoate (CID 6437720) is 3,7-dimethyloct-6-enyl (E)-3-phenylprop-2-enoate.
What is the SMILES notation for 3,7-dimethyloct-6-enyl (E)-3-phenylprop-2-enoate?
The canonical SMILES for 3,7-dimethyloct-6-enyl (E)-3-phenylprop-2-enoate is CC(C)=CCCC(C)CCOC(=O)/C=C/c1ccccc1.
What is the InChIKey of 3,7-dimethyloct-6-enyl (E)-3-phenylprop-2-enoate?
The InChIKey is KMXKQELDKDGFRN-OUKQBFOZSA-N. The full InChI is InChI=1S/C19H26O2/c1-16(2)8-7-9-17(3)14-15-21-19(20)13-12-18-10-5-4-6-11-18/h4-6,8,10-13,17H,7,9,14-15H2,1-3H3/b13-12+.
What are the key properties of 3,7-dimethyloct-6-enyl (E)-3-phenylprop-2-enoate?
3,7-dimethyloct-6-enyl (E)-3-phenylprop-2-enoate has a molecular weight of 286.42 g/mol, XLogP of 5.02, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyloct-6-enyl (E)-3-phenylprop-2-enoate is sourced from PubChem (CID 6437720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).