About 3-[2-hydroxy-3-[(Z)-octadec-9-enoxy]propoxy]propane-1,2-diol
3-[2-hydroxy-3-[(Z)-octadec-9-enoxy]propoxy]propane-1,2-diol (PubChem CID 6437773) has the molecular formula C24H48O5
and a molecular weight of 416.64 g/mol. Its IUPAC name is 3-[2-hydroxy-3-[(Z)-octadec-9-enoxy]propoxy]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[2-hydroxy-3-[(Z)-octadec-9-enoxy]propoxy]propane-1,2-diol |
| PubChem CID | 6437773 |
| Molecular Formula | C24H48O5 |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 416.35 |
| IUPAC Name | 3-[2-hydroxy-3-[(Z)-octadec-9-enoxy]propoxy]propane-1,2-diol |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(O)COCC(O)CO |
| InChI | InChI=1S/C24H48O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-28-21-24(27)22-29-20-23(26)19-25/h9-10,23-27H,2-8,11-22H2,1H3/b10-9- |
| InChIKey | XLJMZTKRCDHLFD-KTKRTIGZSA-N |
| XLogP | 4.77 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-hydroxy-3-[(Z)-octadec-9-enoxy]propoxy]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-hydroxy-3-[(Z)-octadec-9-enoxy]propoxy]propane-1,2-diol?
The IUPAC name of 3-[2-hydroxy-3-[(Z)-octadec-9-enoxy]propoxy]propane-1,2-diol (CID 6437773) is 3-[2-hydroxy-3-[(Z)-octadec-9-enoxy]propoxy]propane-1,2-diol.
What is the SMILES notation for 3-[2-hydroxy-3-[(Z)-octadec-9-enoxy]propoxy]propane-1,2-diol?
The canonical SMILES for 3-[2-hydroxy-3-[(Z)-octadec-9-enoxy]propoxy]propane-1,2-diol is CCCCCCCC/C=C\CCCCCCCCOCC(O)COCC(O)CO.
What is the InChIKey of 3-[2-hydroxy-3-[(Z)-octadec-9-enoxy]propoxy]propane-1,2-diol?
The InChIKey is XLJMZTKRCDHLFD-KTKRTIGZSA-N. The full InChI is InChI=1S/C24H48O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-28-21-24(27)22-29-20-23(26)19-25/h9-10,23-27H,2-8,11-22H2,1H3/b10-9-.
What are the key properties of 3-[2-hydroxy-3-[(Z)-octadec-9-enoxy]propoxy]propane-1,2-diol?
3-[2-hydroxy-3-[(Z)-octadec-9-enoxy]propoxy]propane-1,2-diol has a molecular weight of 416.64 g/mol, XLogP of 4.77, 23 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-hydroxy-3-[(Z)-octadec-9-enoxy]propoxy]propane-1,2-diol is sourced from PubChem (CID 6437773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).