About (Z)-2,3-dichlorobut-2-enedioic acid
(Z)-2,3-dichlorobut-2-enedioic acid (PubChem CID 643797) has the molecular formula C4H2Cl2O4
and a molecular weight of 184.96 g/mol. Its IUPAC name is (Z)-2,3-dichlorobut-2-enedioic acid.
Molecular Properties
| Compound Name | (Z)-2,3-dichlorobut-2-enedioic acid |
| PubChem CID | 643797 |
| Molecular Formula | C4H2Cl2O4 |
| Molecular Weight | 184.96 g/mol |
| Exact Mass | 183.93 |
| IUPAC Name | (Z)-2,3-dichlorobut-2-enedioic acid |
| SMILES | O=C(O)/C(Cl)=C(/Cl)C(=O)O |
| InChI | InChI=1S/C4H2Cl2O4/c5-1(3(7)8)2(6)4(9)10/h(H,7,8)(H,9,10)/b2-1- |
| InChIKey | PNNFEYPWPCDLOC-UPHRSURJSA-N |
| XLogP | 0.84 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.96 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,3-dichlorobut-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,3-dichlorobut-2-enedioic acid?
The IUPAC name of (Z)-2,3-dichlorobut-2-enedioic acid (CID 643797) is (Z)-2,3-dichlorobut-2-enedioic acid.
What is the SMILES notation for (Z)-2,3-dichlorobut-2-enedioic acid?
The canonical SMILES for (Z)-2,3-dichlorobut-2-enedioic acid is O=C(O)/C(Cl)=C(/Cl)C(=O)O.
What is the InChIKey of (Z)-2,3-dichlorobut-2-enedioic acid?
The InChIKey is PNNFEYPWPCDLOC-UPHRSURJSA-N. The full InChI is InChI=1S/C4H2Cl2O4/c5-1(3(7)8)2(6)4(9)10/h(H,7,8)(H,9,10)/b2-1-.
What are the key properties of (Z)-2,3-dichlorobut-2-enedioic acid?
(Z)-2,3-dichlorobut-2-enedioic acid has a molecular weight of 184.96 g/mol, XLogP of 0.84, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,3-dichlorobut-2-enedioic acid is sourced from PubChem (CID 643797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).