About (E)-4-(2,2,3-trimethylcyclopent-3-en-1-yl)but-2-enenitrile
(E)-4-(2,2,3-trimethylcyclopent-3-en-1-yl)but-2-enenitrile (PubChem CID 6437981) has the molecular formula C12H17N
and a molecular weight of 175.28 g/mol. Its IUPAC name is (E)-4-(2,2,3-trimethylcyclopent-3-en-1-yl)but-2-enenitrile.
Molecular Properties
| Compound Name | (E)-4-(2,2,3-trimethylcyclopent-3-en-1-yl)but-2-enenitrile |
| PubChem CID | 6437981 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (E)-4-(2,2,3-trimethylcyclopent-3-en-1-yl)but-2-enenitrile |
| SMILES | CC1=CCC(C/C=C/C#N)C1(C)C |
| InChI | InChI=1S/C12H17N/c1-10-7-8-11(12(10,2)3)6-4-5-9-13/h4-5,7,11H,6,8H2,1-3H3/b5-4+ |
| InChIKey | ZGHAFKNVPNLOPO-SNAWJCMRSA-N |
| XLogP | 3.45 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(2,2,3-trimethylcyclopent-3-en-1-yl)but-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(2,2,3-trimethylcyclopent-3-en-1-yl)but-2-enenitrile?
The IUPAC name of (E)-4-(2,2,3-trimethylcyclopent-3-en-1-yl)but-2-enenitrile (CID 6437981) is (E)-4-(2,2,3-trimethylcyclopent-3-en-1-yl)but-2-enenitrile.
What is the SMILES notation for (E)-4-(2,2,3-trimethylcyclopent-3-en-1-yl)but-2-enenitrile?
The canonical SMILES for (E)-4-(2,2,3-trimethylcyclopent-3-en-1-yl)but-2-enenitrile is CC1=CCC(C/C=C/C#N)C1(C)C.
What is the InChIKey of (E)-4-(2,2,3-trimethylcyclopent-3-en-1-yl)but-2-enenitrile?
The InChIKey is ZGHAFKNVPNLOPO-SNAWJCMRSA-N. The full InChI is InChI=1S/C12H17N/c1-10-7-8-11(12(10,2)3)6-4-5-9-13/h4-5,7,11H,6,8H2,1-3H3/b5-4+.
What are the key properties of (E)-4-(2,2,3-trimethylcyclopent-3-en-1-yl)but-2-enenitrile?
(E)-4-(2,2,3-trimethylcyclopent-3-en-1-yl)but-2-enenitrile has a molecular weight of 175.28 g/mol, XLogP of 3.45, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(2,2,3-trimethylcyclopent-3-en-1-yl)but-2-enenitrile is sourced from PubChem (CID 6437981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).