About N,N-dimethyltetradecan-1-amine;(Z)-octadec-9-enoic acid
N,N-dimethyltetradecan-1-amine;(Z)-octadec-9-enoic acid (PubChem CID 6437985) has the molecular formula C34H69NO2
and a molecular weight of 523.93 g/mol. Its IUPAC name is N,N-dimethyltetradecan-1-amine;(Z)-octadec-9-enoic acid.
Molecular Properties
| Compound Name | N,N-dimethyltetradecan-1-amine;(Z)-octadec-9-enoic acid |
| PubChem CID | 6437985 |
| Molecular Formula | C34H69NO2 |
| Molecular Weight | 523.93 g/mol |
| Exact Mass | 523.53 |
| IUPAC Name | N,N-dimethyltetradecan-1-amine;(Z)-octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.CCCCCCCCCCCCCCN(C)C |
| InChI | InChI=1S/C18H34O2.C16H35N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)3/h9-10H,2-8,11-17H2,1H3,(H,19,20);4-16H2,1-3H3/b10-9-; |
| InChIKey | URQJVDIQFZLSQF-KVVVOXFISA-N |
| XLogP | 11.36 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 523.93 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyltetradecan-1-amine;(Z)-octadec-9-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyltetradecan-1-amine;(Z)-octadec-9-enoic acid?
The IUPAC name of N,N-dimethyltetradecan-1-amine;(Z)-octadec-9-enoic acid (CID 6437985) is N,N-dimethyltetradecan-1-amine;(Z)-octadec-9-enoic acid.
What is the SMILES notation for N,N-dimethyltetradecan-1-amine;(Z)-octadec-9-enoic acid?
The canonical SMILES for N,N-dimethyltetradecan-1-amine;(Z)-octadec-9-enoic acid is CCCCCCCC/C=C\CCCCCCCC(=O)O.CCCCCCCCCCCCCCN(C)C.
What is the InChIKey of N,N-dimethyltetradecan-1-amine;(Z)-octadec-9-enoic acid?
The InChIKey is URQJVDIQFZLSQF-KVVVOXFISA-N. The full InChI is InChI=1S/C18H34O2.C16H35N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)3/h9-10H,2-8,11-17H2,1H3,(H,19,20);4-16H2,1-3H3/b10-9-;.
What are the key properties of N,N-dimethyltetradecan-1-amine;(Z)-octadec-9-enoic acid?
N,N-dimethyltetradecan-1-amine;(Z)-octadec-9-enoic acid has a molecular weight of 523.93 g/mol, XLogP of 11.36, 28 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyltetradecan-1-amine;(Z)-octadec-9-enoic acid is sourced from PubChem (CID 6437985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).