About (3Z)-3,7-dimethylocta-3,6-dienenitrile
(3Z)-3,7-dimethylocta-3,6-dienenitrile (PubChem CID 6438054) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is (3Z)-3,7-dimethylocta-3,6-dienenitrile.
Molecular Properties
| Compound Name | (3Z)-3,7-dimethylocta-3,6-dienenitrile |
| PubChem CID | 6438054 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (3Z)-3,7-dimethylocta-3,6-dienenitrile |
| SMILES | CC(C)=CC/C=C(/C)CC#N |
| InChI | InChI=1S/C10H15N/c1-9(2)5-4-6-10(3)7-8-11/h5-6H,4,7H2,1-3H3/b10-6- |
| InChIKey | LNWFHUTYUOYNBG-POHAHGRESA-N |
| XLogP | 3.20 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3,7-dimethylocta-3,6-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3,7-dimethylocta-3,6-dienenitrile?
The IUPAC name of (3Z)-3,7-dimethylocta-3,6-dienenitrile (CID 6438054) is (3Z)-3,7-dimethylocta-3,6-dienenitrile.
What is the SMILES notation for (3Z)-3,7-dimethylocta-3,6-dienenitrile?
The canonical SMILES for (3Z)-3,7-dimethylocta-3,6-dienenitrile is CC(C)=CC/C=C(/C)CC#N.
What is the InChIKey of (3Z)-3,7-dimethylocta-3,6-dienenitrile?
The InChIKey is LNWFHUTYUOYNBG-POHAHGRESA-N. The full InChI is InChI=1S/C10H15N/c1-9(2)5-4-6-10(3)7-8-11/h5-6H,4,7H2,1-3H3/b10-6-.
What are the key properties of (3Z)-3,7-dimethylocta-3,6-dienenitrile?
(3Z)-3,7-dimethylocta-3,6-dienenitrile has a molecular weight of 149.24 g/mol, XLogP of 3.20, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3,7-dimethylocta-3,6-dienenitrile is sourced from PubChem (CID 6438054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).