C39H72O7 — CID 6438175
[2-hydroxy-3-[(E)-12-hydroxyoctadec-9-enoyl]oxypropyl] (E)-12-hydroxyoctadec-9-enoate (PubChem CID 6438175) has the molecular formula C39H72O7 and a molecular weight of 653.00 g/mol. Its IUPAC name is [2-hydroxy-3-[(E)-12-hydroxyoctadec-9-enoyl]oxypropyl] (E)-12-hydroxyoctadec-9-enoate.
| Compound Name | [2-hydroxy-3-[(E)-12-hydroxyoctadec-9-enoyl]oxypropyl] (E)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 6438175 |
| Molecular Formula | C39H72O7 |
| Molecular Weight | 653.00 g/mol |
| Exact Mass | 652.53 |
| IUPAC Name | [2-hydroxy-3-[(E)-12-hydroxyoctadec-9-enoyl]oxypropyl] (E)-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCCC(O)C/C=C/CCCCCCCC(=O)OCC(O)COC(=O)CCCCCCC/C=C/CC(O)CCCCCC |
| InChI | InChI=1S/C39H72O7/c1-3-5-7-21-27-35(40)29-23-17-13-9-11-15-19-25-31-38(43)45-33-37(42)34-46-39(44)32-26-20-16-12-10-14-18-24-30-36(41)28-22-8-6-4-2/h17-18,23-24,35-37,40-42H,3-16,19-22,25-34H2,1-2H3/b23-17+,24-18+ |
| InChIKey | SUEGNWDYVDUYBZ-GJHDBBOXSA-N |
| XLogP | 9.45 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.00 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|