(Z)-octadec-9-en-1-amine;(Z)-octadec-9-enoic acid

C36H71NO2 — CID 6438187

IUPAC(Z)-octadec-9-en-1-amine;(Z)-octadec-9-enoic acid
SMILESCCCCCCCC/C=C\CCCCCCCC(=O)O.CCCCCCCC/C=C\CCCCCCCCN
InChIInChI=1S/C18H37N.C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-19H2,1H3;9-10H,2-8,11-17H2,1H3,(H,19,20)/b2*10-9-
InChIKeyQAIHWMZHLIBAFX-QZOPMXJLSA-N
MW549.97 g/mol
LogP12.09
Rot. Bonds30

About (Z)-octadec-9-en-1-amine;(Z)-octadec-9-enoic acid

(Z)-octadec-9-en-1-amine;(Z)-octadec-9-enoic acid (PubChem CID 6438187) has the molecular formula C36H71NO2 and a molecular weight of 549.97 g/mol. Its IUPAC name is (Z)-octadec-9-en-1-amine;(Z)-octadec-9-enoic acid.

Molecular Properties

Compound Name(Z)-octadec-9-en-1-amine;(Z)-octadec-9-enoic acid
PubChem CID6438187
Molecular FormulaC36H71NO2
Molecular Weight549.97 g/mol
Exact Mass549.55
IUPAC Name(Z)-octadec-9-en-1-amine;(Z)-octadec-9-enoic acid
SMILESCCCCCCCC/C=C\CCCCCCCC(=O)O.CCCCCCCC/C=C\CCCCCCCCN
InChIInChI=1S/C18H37N.C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-19H2,1H3;9-10H,2-8,11-17H2,1H3,(H,19,20)/b2*10-9-
InChIKeyQAIHWMZHLIBAFX-QZOPMXJLSA-N
XLogP12.09
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds30
Heavy Atoms39
Complexity—

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500549.97
LogP ≤ 512.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (Z)-octadec-9-en-1-amine;(Z)-octadec-9-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-octadec-9-en-1-amine;(Z)-octadec-9-enoic acid?
The IUPAC name of (Z)-octadec-9-en-1-amine;(Z)-octadec-9-enoic acid (CID 6438187) is (Z)-octadec-9-en-1-amine;(Z)-octadec-9-enoic acid.
What is the SMILES notation for (Z)-octadec-9-en-1-amine;(Z)-octadec-9-enoic acid?
The canonical SMILES for (Z)-octadec-9-en-1-amine;(Z)-octadec-9-enoic acid is CCCCCCCC/C=C\CCCCCCCC(=O)O.CCCCCCCC/C=C\CCCCCCCCN.
What is the InChIKey of (Z)-octadec-9-en-1-amine;(Z)-octadec-9-enoic acid?
The InChIKey is QAIHWMZHLIBAFX-QZOPMXJLSA-N. The full InChI is InChI=1S/C18H37N.C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-19H2,1H3;9-10H,2-8,11-17H2,1H3,(H,19,20)/b2*10-9-.
What are the key properties of (Z)-octadec-9-en-1-amine;(Z)-octadec-9-enoic acid?
(Z)-octadec-9-en-1-amine;(Z)-octadec-9-enoic acid has a molecular weight of 549.97 g/mol, XLogP of 12.09, 30 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-octadec-9-en-1-amine;(Z)-octadec-9-enoic acid is sourced from PubChem (CID 6438187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).