About (2E)-2-[(3-amino-2,4,6-triiodophenyl)methylidene]butanoic acid
(2E)-2-[(3-amino-2,4,6-triiodophenyl)methylidene]butanoic acid (PubChem CID 6438254) has the molecular formula C11H10I3NO2
and a molecular weight of 568.92 g/mol. Its IUPAC name is (2E)-2-[(3-amino-2,4,6-triiodophenyl)methylidene]butanoic acid.
Molecular Properties
| Compound Name | (2E)-2-[(3-amino-2,4,6-triiodophenyl)methylidene]butanoic acid |
| PubChem CID | 6438254 |
| Molecular Formula | C11H10I3NO2 |
| Molecular Weight | 568.92 g/mol |
| Exact Mass | 568.78 |
| IUPAC Name | (2E)-2-[(3-amino-2,4,6-triiodophenyl)methylidene]butanoic acid |
| SMILES | CC/C(=C\c1c(I)cc(I)c(N)c1I)C(=O)O |
| InChI | InChI=1S/C11H10I3NO2/c1-2-5(11(16)17)3-6-7(12)4-8(13)10(15)9(6)14/h3-4H,2,15H2,1H3,(H,16,17)/b5-3+ |
| InChIKey | WRRIFEUVZSLRCF-HWKANZROSA-N |
| XLogP | 3.96 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 568.92 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(3-amino-2,4,6-triiodophenyl)methylidene]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(3-amino-2,4,6-triiodophenyl)methylidene]butanoic acid?
The IUPAC name of (2E)-2-[(3-amino-2,4,6-triiodophenyl)methylidene]butanoic acid (CID 6438254) is (2E)-2-[(3-amino-2,4,6-triiodophenyl)methylidene]butanoic acid.
What is the SMILES notation for (2E)-2-[(3-amino-2,4,6-triiodophenyl)methylidene]butanoic acid?
The canonical SMILES for (2E)-2-[(3-amino-2,4,6-triiodophenyl)methylidene]butanoic acid is CC/C(=C\c1c(I)cc(I)c(N)c1I)C(=O)O.
What is the InChIKey of (2E)-2-[(3-amino-2,4,6-triiodophenyl)methylidene]butanoic acid?
The InChIKey is WRRIFEUVZSLRCF-HWKANZROSA-N. The full InChI is InChI=1S/C11H10I3NO2/c1-2-5(11(16)17)3-6-7(12)4-8(13)10(15)9(6)14/h3-4H,2,15H2,1H3,(H,16,17)/b5-3+.
What are the key properties of (2E)-2-[(3-amino-2,4,6-triiodophenyl)methylidene]butanoic acid?
(2E)-2-[(3-amino-2,4,6-triiodophenyl)methylidene]butanoic acid has a molecular weight of 568.92 g/mol, XLogP of 3.96, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(3-amino-2,4,6-triiodophenyl)methylidene]butanoic acid is sourced from PubChem (CID 6438254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).