About methyl 4-[(2S)-2-[[(2S)-2-hydroxy-2-phenylethyl]amino]propyl]benzoate;(E)-4-oxopent-2-enoic acid
methyl 4-[(2S)-2-[[(2S)-2-hydroxy-2-phenylethyl]amino]propyl]benzoate;(E)-4-oxopent-2-enoic acid (PubChem CID 6438331) has the molecular formula C24H29NO6
and a molecular weight of 427.50 g/mol. Its IUPAC name is methyl 4-[(2S)-2-[[(2S)-2-hydroxy-2-phenylethyl]amino]propyl]benzoate;(E)-4-oxopent-2-enoic acid.
Molecular Properties
| Compound Name | methyl 4-[(2S)-2-[[(2S)-2-hydroxy-2-phenylethyl]amino]propyl]benzoate;(E)-4-oxopent-2-enoic acid |
| PubChem CID | 6438331 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | methyl 4-[(2S)-2-[[(2S)-2-hydroxy-2-phenylethyl]amino]propyl]benzoate;(E)-4-oxopent-2-enoic acid |
| SMILES | CC(=O)/C=C/C(=O)O.COC(=O)c1ccc(C[C@H](C)NC[C@@H](O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NO3.C5H6O3/c1-14(20-13-18(21)16-6-4-3-5-7-16)12-15-8-10-17(11-9-15)19(22)23-2;1-4(6)2-3-5(7)8/h3-11,14,18,20-21H,12-13H2,1-2H3;2-3H,1H3,(H,7,8)/b;3-2+/t14-,18+;/m0./s1 |
| InChIKey | OIZISCUUSLPUEN-LMORPYAASA-N |
| XLogP | 2.94 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(2S)-2-[[(2S)-2-hydroxy-2-phenylethyl]amino]propyl]benzoate;(E)-4-oxopent-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(2S)-2-[[(2S)-2-hydroxy-2-phenylethyl]amino]propyl]benzoate;(E)-4-oxopent-2-enoic acid?
The IUPAC name of methyl 4-[(2S)-2-[[(2S)-2-hydroxy-2-phenylethyl]amino]propyl]benzoate;(E)-4-oxopent-2-enoic acid (CID 6438331) is methyl 4-[(2S)-2-[[(2S)-2-hydroxy-2-phenylethyl]amino]propyl]benzoate;(E)-4-oxopent-2-enoic acid.
What is the SMILES notation for methyl 4-[(2S)-2-[[(2S)-2-hydroxy-2-phenylethyl]amino]propyl]benzoate;(E)-4-oxopent-2-enoic acid?
The canonical SMILES for methyl 4-[(2S)-2-[[(2S)-2-hydroxy-2-phenylethyl]amino]propyl]benzoate;(E)-4-oxopent-2-enoic acid is CC(=O)/C=C/C(=O)O.COC(=O)c1ccc(C[C@H](C)NC[C@@H](O)c2ccccc2)cc1.
What is the InChIKey of methyl 4-[(2S)-2-[[(2S)-2-hydroxy-2-phenylethyl]amino]propyl]benzoate;(E)-4-oxopent-2-enoic acid?
The InChIKey is OIZISCUUSLPUEN-LMORPYAASA-N. The full InChI is InChI=1S/C19H23NO3.C5H6O3/c1-14(20-13-18(21)16-6-4-3-5-7-16)12-15-8-10-17(11-9-15)19(22)23-2;1-4(6)2-3-5(7)8/h3-11,14,18,20-21H,12-13H2,1-2H3;2-3H,1H3,(H,7,8)/b;3-2+/t14-,18+;/m0./s1.
What are the key properties of methyl 4-[(2S)-2-[[(2S)-2-hydroxy-2-phenylethyl]amino]propyl]benzoate;(E)-4-oxopent-2-enoic acid?
methyl 4-[(2S)-2-[[(2S)-2-hydroxy-2-phenylethyl]amino]propyl]benzoate;(E)-4-oxopent-2-enoic acid has a molecular weight of 427.50 g/mol, XLogP of 2.94, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2S)-2-[[(2S)-2-hydroxy-2-phenylethyl]amino]propyl]benzoate;(E)-4-oxopent-2-enoic acid is sourced from PubChem (CID 6438331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).