About (E)-2-(3,4-dimethoxyphenyl)-3-fluoroprop-2-en-1-amine
(E)-2-(3,4-dimethoxyphenyl)-3-fluoroprop-2-en-1-amine (PubChem CID 6438383) has the molecular formula C11H14FNO2
and a molecular weight of 211.24 g/mol. Its IUPAC name is (E)-2-(3,4-dimethoxyphenyl)-3-fluoroprop-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-2-(3,4-dimethoxyphenyl)-3-fluoroprop-2-en-1-amine |
| PubChem CID | 6438383 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (E)-2-(3,4-dimethoxyphenyl)-3-fluoroprop-2-en-1-amine |
| SMILES | COc1ccc(/C(=C\F)CN)cc1OC |
| InChI | InChI=1S/C11H14FNO2/c1-14-10-4-3-8(5-11(10)15-2)9(6-12)7-13/h3-6H,7,13H2,1-2H3/b9-6- |
| InChIKey | HLNSVKSSCLHOSW-TWGQIWQCSA-N |
| XLogP | 1.97 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (E)-2-(3,4-dimethoxyphenyl)-3-fluoroprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-(3,4-dimethoxyphenyl)-3-fluoroprop-2-en-1-amine?
The IUPAC name of (E)-2-(3,4-dimethoxyphenyl)-3-fluoroprop-2-en-1-amine (CID 6438383) is (E)-2-(3,4-dimethoxyphenyl)-3-fluoroprop-2-en-1-amine.
What is the SMILES notation for (E)-2-(3,4-dimethoxyphenyl)-3-fluoroprop-2-en-1-amine?
The canonical SMILES for (E)-2-(3,4-dimethoxyphenyl)-3-fluoroprop-2-en-1-amine is COc1ccc(/C(=C\F)CN)cc1OC.
What is the InChIKey of (E)-2-(3,4-dimethoxyphenyl)-3-fluoroprop-2-en-1-amine?
The InChIKey is HLNSVKSSCLHOSW-TWGQIWQCSA-N. The full InChI is InChI=1S/C11H14FNO2/c1-14-10-4-3-8(5-11(10)15-2)9(6-12)7-13/h3-6H,7,13H2,1-2H3/b9-6-.
What are the key properties of (E)-2-(3,4-dimethoxyphenyl)-3-fluoroprop-2-en-1-amine?
(E)-2-(3,4-dimethoxyphenyl)-3-fluoroprop-2-en-1-amine has a molecular weight of 211.24 g/mol, XLogP of 1.97, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(3,4-dimethoxyphenyl)-3-fluoroprop-2-en-1-amine is sourced from PubChem (CID 6438383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).