C29H37N5O7 — CID 6438539
2-[[(E)-2-[[2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]acetyl]amino]-3-phenylprop-2-enoyl]amino]-3-methylpentanoic acid (PubChem CID 6438539) has the molecular formula C29H37N5O7 and a molecular weight of 567.64 g/mol. Its IUPAC name is 2-[[(E)-2-[[2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]acetyl]amino]-3-phenylprop-2-enoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[(E)-2-[[2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]acetyl]amino]-3-phenylprop-2-enoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 6438539 |
| Molecular Formula | C29H37N5O7 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | 2-[[(E)-2-[[2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]acetyl]amino]-3-phenylprop-2-enoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)/C(=C\c1ccccc1)NC(=O)CNC(=O)C(C)NC(=O)C(N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C29H37N5O7/c1-4-17(2)25(29(40)41)34-28(39)23(15-19-8-6-5-7-9-19)33-24(36)16-31-26(37)18(3)32-27(38)22(30)14-20-10-12-21(35)13-11-20/h5-13,15,17-18,22,25,35H,4,14,16,30H2,1-3H3,(H,31,37)(H,32,38)(H,33,36)(H,34,39)(H,40,41)/b23-15+ |
| InChIKey | XVSZJDCTYJNUKL-HZHRSRAPSA-N |
| XLogP | 0.66 |
| TPSA | 199.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|