C8H14O5 — CID 6438548
(2Z,3R,4S,5S,6R)-2-ethylidene-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 6438548) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is (2Z,3R,4S,5S,6R)-2-ethylidene-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2Z,3R,4S,5S,6R)-2-ethylidene-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 6438548 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (2Z,3R,4S,5S,6R)-2-ethylidene-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C/C=C1\O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H14O5/c1-2-4-6(10)8(12)7(11)5(3-9)13-4/h2,5-12H,3H2,1H3/b4-2-/t5-,6+,7-,8-/m1/s1 |
| InChIKey | UKZREQMNJZDGAA-FUOVIMJWSA-N |
| XLogP | -1.64 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |