About [3-anilino-2-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate
[3-anilino-2-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate (PubChem CID 6438605) has the molecular formula C45H77NO4
and a molecular weight of 696.11 g/mol. Its IUPAC name is [3-anilino-2-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate.
Molecular Properties
| Compound Name | [3-anilino-2-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate |
| PubChem CID | 6438605 |
| Molecular Formula | C45H77NO4 |
| Molecular Weight | 696.11 g/mol |
| Exact Mass | 695.59 |
| IUPAC Name | [3-anilino-2-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OCC(CNc1ccccc1)OC(=O)CCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C45H77NO4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-34-38-44(47)49-41-43(40-46-42-36-32-31-33-37-42)50-45(48)39-35-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,31-33,36-37,43,46H,3-16,21-30,34-35,38-41H2,1-2H3/b19-17+,20-18+ |
| InChIKey | WQRUPNMGAOGBKC-XPWSMXQVSA-N |
| XLogP | 13.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 696.11 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [3-anilino-2-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-anilino-2-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate?
The IUPAC name of [3-anilino-2-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate (CID 6438605) is [3-anilino-2-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate.
What is the SMILES notation for [3-anilino-2-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate?
The canonical SMILES for [3-anilino-2-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate is CCCCCCCC/C=C/CCCCCCCC(=O)OCC(CNc1ccccc1)OC(=O)CCCCCCC/C=C/CCCCCCCC.
What is the InChIKey of [3-anilino-2-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate?
The InChIKey is WQRUPNMGAOGBKC-XPWSMXQVSA-N. The full InChI is InChI=1S/C45H77NO4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-34-38-44(47)49-41-43(40-46-42-36-32-31-33-37-42)50-45(48)39-35-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,31-33,36-37,43,46H,3-16,21-30,34-35,38-41H2,1-2H3/b19-17+,20-18+.
What are the key properties of [3-anilino-2-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate?
[3-anilino-2-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate has a molecular weight of 696.11 g/mol, XLogP of 13.63, 36 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-anilino-2-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate is sourced from PubChem (CID 6438605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).