C24H30O — CID 6438709
[4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl]methanol (PubChem CID 6438709) has the molecular formula C24H30O and a molecular weight of 334.50 g/mol. Its IUPAC name is [4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl]methanol.
| Compound Name | [4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl]methanol |
|---|---|
| PubChem CID | 6438709 |
| Molecular Formula | C24H30O |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | [4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl]methanol |
| SMILES | C/C(=C\c1ccc(CO)cc1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C24H30O/c1-17(14-18-6-8-19(16-25)9-7-18)20-10-11-21-22(15-20)24(4,5)13-12-23(21,2)3/h6-11,14-15,25H,12-13,16H2,1-5H3/b17-14+ |
| InChIKey | GWODBVDCNSWNFM-SAPNQHFASA-N |
| XLogP | 6.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|