About (E)-5-aminopent-2-enoic acid
(E)-5-aminopent-2-enoic acid (PubChem CID 6439117) has the molecular formula C5H9NO2
and a molecular weight of 115.13 g/mol. Its IUPAC name is (E)-5-aminopent-2-enoic acid.
Molecular Properties
| Compound Name | (E)-5-aminopent-2-enoic acid |
| PubChem CID | 6439117 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | (E)-5-aminopent-2-enoic acid |
| SMILES | NCC/C=C/C(=O)O |
| InChI | InChI=1S/C5H9NO2/c6-4-2-1-3-5(7)8/h1,3H,2,4,6H2,(H,7,8)/b3-1+ |
| InChIKey | ZCMCFTFHSMPGKZ-HNQUOIGGSA-N |
| XLogP | -0.02 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-aminopent-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-aminopent-2-enoic acid?
The IUPAC name of (E)-5-aminopent-2-enoic acid (CID 6439117) is (E)-5-aminopent-2-enoic acid.
What is the SMILES notation for (E)-5-aminopent-2-enoic acid?
The canonical SMILES for (E)-5-aminopent-2-enoic acid is NCC/C=C/C(=O)O.
What is the InChIKey of (E)-5-aminopent-2-enoic acid?
The InChIKey is ZCMCFTFHSMPGKZ-HNQUOIGGSA-N. The full InChI is InChI=1S/C5H9NO2/c6-4-2-1-3-5(7)8/h1,3H,2,4,6H2,(H,7,8)/b3-1+.
What are the key properties of (E)-5-aminopent-2-enoic acid?
(E)-5-aminopent-2-enoic acid has a molecular weight of 115.13 g/mol, XLogP of -0.02, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-aminopent-2-enoic acid is sourced from PubChem (CID 6439117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).