C20H31FO4 — CID 6439119
(Z)-7-[(1R,2R)-2-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 6439119) has the molecular formula C20H31FO4 and a molecular weight of 354.46 g/mol. Its IUPAC name is (Z)-7-[(1R,2R)-2-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R)-2-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 6439119 |
| Molecular Formula | C20H31FO4 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (Z)-7-[(1R,2R)-2-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCCC[C@@H](F)[C@H](O)/C=C/[C@H]1CCC(=O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H31FO4/c1-2-3-9-17(21)19(23)14-12-15-11-13-18(22)16(15)8-6-4-5-7-10-20(24)25/h4,6,12,14-17,19,23H,2-3,5,7-11,13H2,1H3,(H,24,25)/b6-4-,14-12+/t15-,16-,17-,19-/m1/s1 |
| InChIKey | RSKCOQGXAAVUQD-MUANAFEKSA-N |
| XLogP | 4.23 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|