C23H37IO5 — CID 6439128
methyl 5-[(3aR,4R,5R,6aR)-4-[(E)-4-ethenyl-4-hydroxyoct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate (PubChem CID 6439128) has the molecular formula C23H37IO5 and a molecular weight of 520.45 g/mol. Its IUPAC name is methyl 5-[(3aR,4R,5R,6aR)-4-[(E)-4-ethenyl-4-hydroxyoct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate.
| Compound Name | methyl 5-[(3aR,4R,5R,6aR)-4-[(E)-4-ethenyl-4-hydroxyoct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate |
|---|---|
| PubChem CID | 6439128 |
| Molecular Formula | C23H37IO5 |
| Molecular Weight | 520.45 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | methyl 5-[(3aR,4R,5R,6aR)-4-[(E)-4-ethenyl-4-hydroxyoct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate |
| SMILES | C=CC(O)(C/C=C/[C@@H]1[C@H]2CC(C(I)CCCC(=O)OC)O[C@@H]2C[C@H]1O)CCCC |
| InChI | InChI=1S/C23H37IO5/c1-4-6-12-23(27,5-2)13-8-9-16-17-14-21(29-20(17)15-19(16)25)18(24)10-7-11-22(26)28-3/h5,8-9,16-21,25,27H,2,4,6-7,10-15H2,1,3H3/b9-8+/t16-,17-,18?,19-,20-,21?,23?/m1/s1 |
| InChIKey | RCVQEPANKVORNY-KFGLQACNSA-N |
| XLogP | 4.34 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|