About (Z)-2-methylbut-2-enoic acid
(Z)-2-methylbut-2-enoic acid (PubChem CID 643915) has the molecular formula C5H8O2
and a molecular weight of 100.12 g/mol. Its IUPAC name is (Z)-2-methylbut-2-enoic acid.
Molecular Properties
| Compound Name | (Z)-2-methylbut-2-enoic acid |
| PubChem CID | 643915 |
| Molecular Formula | C5H8O2 |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.05 |
| IUPAC Name | (Z)-2-methylbut-2-enoic acid |
| SMILES | C/C=C(/C)C(=O)O |
| InChI | InChI=1S/C5H8O2/c1-3-4(2)5(6)7/h3H,1-2H3,(H,6,7)/b4-3- |
| InChIKey | UIERETOOQGIECD-ARJAWSKDSA-N |
| XLogP | 1.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-methylbut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-methylbut-2-enoic acid?
The IUPAC name of (Z)-2-methylbut-2-enoic acid (CID 643915) is (Z)-2-methylbut-2-enoic acid.
What is the SMILES notation for (Z)-2-methylbut-2-enoic acid?
The canonical SMILES for (Z)-2-methylbut-2-enoic acid is C/C=C(/C)C(=O)O.
What is the InChIKey of (Z)-2-methylbut-2-enoic acid?
The InChIKey is UIERETOOQGIECD-ARJAWSKDSA-N. The full InChI is InChI=1S/C5H8O2/c1-3-4(2)5(6)7/h3H,1-2H3,(H,6,7)/b4-3-.
What are the key properties of (Z)-2-methylbut-2-enoic acid?
(Z)-2-methylbut-2-enoic acid has a molecular weight of 100.12 g/mol, XLogP of 1.04, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-methylbut-2-enoic acid is sourced from PubChem (CID 643915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).