C14H14OS — CID 6439221
2,6-dimethyl-4-[(E)-2-thiophen-2-ylethenyl]phenol (PubChem CID 6439221) has the molecular formula C14H14OS and a molecular weight of 230.33 g/mol. Its IUPAC name is 2,6-dimethyl-4-[(E)-2-thiophen-2-ylethenyl]phenol.
| Compound Name | 2,6-dimethyl-4-[(E)-2-thiophen-2-ylethenyl]phenol |
|---|---|
| PubChem CID | 6439221 |
| Molecular Formula | C14H14OS |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 2,6-dimethyl-4-[(E)-2-thiophen-2-ylethenyl]phenol |
| SMILES | Cc1cc(/C=C/c2cccs2)cc(C)c1O |
| InChI | InChI=1S/C14H14OS/c1-10-8-12(9-11(2)14(10)15)5-6-13-4-3-7-16-13/h3-9,15H,1-2H3/b6-5+ |
| InChIKey | CUTHZVKEIWXBMP-AATRIKPKSA-N |
| XLogP | 4.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |