About (4E)-4-ethylidene-2,6,6-trimethylcyclohex-2-en-1-one
(4E)-4-ethylidene-2,6,6-trimethylcyclohex-2-en-1-one (PubChem CID 643928) has the molecular formula C11H16O
and a molecular weight of 164.25 g/mol. Its IUPAC name is (4E)-4-ethylidene-2,6,6-trimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | (4E)-4-ethylidene-2,6,6-trimethylcyclohex-2-en-1-one |
| PubChem CID | 643928 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (4E)-4-ethylidene-2,6,6-trimethylcyclohex-2-en-1-one |
| SMILES | C/C=C1/C=C(C)C(=O)C(C)(C)C1 |
| InChI | InChI=1S/C11H16O/c1-5-9-6-8(2)10(12)11(3,4)7-9/h5-6H,7H2,1-4H3/b9-5- |
| InChIKey | GHZGOFPPZRIGRM-UITAMQMPSA-N |
| XLogP | 2.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4E)-4-ethylidene-2,6,6-trimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-ethylidene-2,6,6-trimethylcyclohex-2-en-1-one?
The IUPAC name of (4E)-4-ethylidene-2,6,6-trimethylcyclohex-2-en-1-one (CID 643928) is (4E)-4-ethylidene-2,6,6-trimethylcyclohex-2-en-1-one.
What is the SMILES notation for (4E)-4-ethylidene-2,6,6-trimethylcyclohex-2-en-1-one?
The canonical SMILES for (4E)-4-ethylidene-2,6,6-trimethylcyclohex-2-en-1-one is C/C=C1/C=C(C)C(=O)C(C)(C)C1.
What is the InChIKey of (4E)-4-ethylidene-2,6,6-trimethylcyclohex-2-en-1-one?
The InChIKey is GHZGOFPPZRIGRM-UITAMQMPSA-N. The full InChI is InChI=1S/C11H16O/c1-5-9-6-8(2)10(12)11(3,4)7-9/h5-6H,7H2,1-4H3/b9-5-.
What are the key properties of (4E)-4-ethylidene-2,6,6-trimethylcyclohex-2-en-1-one?
(4E)-4-ethylidene-2,6,6-trimethylcyclohex-2-en-1-one has a molecular weight of 164.25 g/mol, XLogP of 2.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-ethylidene-2,6,6-trimethylcyclohex-2-en-1-one is sourced from PubChem (CID 643928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).