C11H24NO2+ — CID 6439410
[(E,2S,3R)-1,3-dihydroxyoct-4-en-2-yl]-trimethylazanium (PubChem CID 6439410) has the molecular formula C11H24NO2+ and a molecular weight of 202.32 g/mol. Its IUPAC name is [(E,2S,3R)-1,3-dihydroxyoct-4-en-2-yl]-trimethylazanium.
| Compound Name | [(E,2S,3R)-1,3-dihydroxyoct-4-en-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 6439410 |
| Molecular Formula | C11H24NO2+ |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.18 |
| IUPAC Name | [(E,2S,3R)-1,3-dihydroxyoct-4-en-2-yl]-trimethylazanium |
| SMILES | CCC/C=C/[C@@H](O)[C@H](CO)[N+](C)(C)C |
| InChI | InChI=1S/C11H24NO2/c1-5-6-7-8-11(14)10(9-13)12(2,3)4/h7-8,10-11,13-14H,5-6,9H2,1-4H3/q+1/b8-7+/t10-,11+/m0/s1 |
| InChIKey | HPUYQTKUQJNJQO-IAYMVZNDSA-N |
| XLogP | 0.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|