C17H25BrO2 — CID 6439580
[(2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl] 2-bromoacetate (PubChem CID 6439580) has the molecular formula C17H25BrO2 and a molecular weight of 341.29 g/mol. Its IUPAC name is [(2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl] 2-bromoacetate.
| Compound Name | [(2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl] 2-bromoacetate |
|---|---|
| PubChem CID | 6439580 |
| Molecular Formula | C17H25BrO2 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | [(2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl] 2-bromoacetate |
| SMILES | CC1=C(/C=C/C(C)=C/COC(=O)CBr)C(C)(C)CCC1 |
| InChI | InChI=1S/C17H25BrO2/c1-13(9-11-20-16(19)12-18)7-8-15-14(2)6-5-10-17(15,3)4/h7-9H,5-6,10-12H2,1-4H3/b8-7+,13-9+ |
| InChIKey | ALKXAVUXOREVOR-NJHPPEEMSA-N |
| XLogP | 4.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|