About (E)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-2-enal
(E)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-2-enal (PubChem CID 6439704) has the molecular formula C8H8N2O3
and a molecular weight of 180.16 g/mol. Its IUPAC name is (E)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-2-enal.
Molecular Properties
| Compound Name | (E)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-2-enal |
| PubChem CID | 6439704 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | (E)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-2-enal |
| SMILES | Cc1cn(/C=C/C=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H8N2O3/c1-6-5-10(3-2-4-11)8(13)9-7(6)12/h2-5H,1H3,(H,9,12,13)/b3-2+ |
| InChIKey | CDPXAPVOBNKPPD-NSCUHMNNSA-N |
| XLogP | -0.49 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-2-enal?
The IUPAC name of (E)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-2-enal (CID 6439704) is (E)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-2-enal.
What is the SMILES notation for (E)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-2-enal?
The canonical SMILES for (E)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-2-enal is Cc1cn(/C=C/C=O)c(=O)[nH]c1=O.
What is the InChIKey of (E)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-2-enal?
The InChIKey is CDPXAPVOBNKPPD-NSCUHMNNSA-N. The full InChI is InChI=1S/C8H8N2O3/c1-6-5-10(3-2-4-11)8(13)9-7(6)12/h2-5H,1H3,(H,9,12,13)/b3-2+.
What are the key properties of (E)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-2-enal?
(E)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-2-enal has a molecular weight of 180.16 g/mol, XLogP of -0.49, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-2-enal is sourced from PubChem (CID 6439704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).