C21H32S — CID 6439784
2-[(1Z,3Z,5Z,7Z)-3,7-dimethyl-9-methylsulfanylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene (PubChem CID 6439784) has the molecular formula C21H32S and a molecular weight of 316.55 g/mol. Its IUPAC name is 2-[(1Z,3Z,5Z,7Z)-3,7-dimethyl-9-methylsulfanylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(1Z,3Z,5Z,7Z)-3,7-dimethyl-9-methylsulfanylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 6439784 |
| Molecular Formula | C21H32S |
| Molecular Weight | 316.55 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 2-[(1Z,3Z,5Z,7Z)-3,7-dimethyl-9-methylsulfanylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene |
| SMILES | CSC/C=C(C)\C=C/C=C(C)\C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C21H32S/c1-17(9-7-10-18(2)14-16-22-6)12-13-20-19(3)11-8-15-21(20,4)5/h7,9-10,12-14H,8,11,15-16H2,1-6H3/b10-7-,13-12-,17-9-,18-14- |
| InChIKey | OACVEWOXNNWAQG-IQCIHMQOSA-N |
| XLogP | 6.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.55 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|