C29H51N — CID 6439791
(4Z,8Z,12Z,16Z)-N,N,4,8,13,17,21-heptamethyldocosa-4,8,12,16,20-pentaen-1-amine (PubChem CID 6439791) has the molecular formula C29H51N and a molecular weight of 413.73 g/mol. Its IUPAC name is (4Z,8Z,12Z,16Z)-N,N,4,8,13,17,21-heptamethyldocosa-4,8,12,16,20-pentaen-1-amine.
| Compound Name | (4Z,8Z,12Z,16Z)-N,N,4,8,13,17,21-heptamethyldocosa-4,8,12,16,20-pentaen-1-amine |
|---|---|
| PubChem CID | 6439791 |
| Molecular Formula | C29H51N |
| Molecular Weight | 413.73 g/mol |
| Exact Mass | 413.40 |
| IUPAC Name | (4Z,8Z,12Z,16Z)-N,N,4,8,13,17,21-heptamethyldocosa-4,8,12,16,20-pentaen-1-amine |
| SMILES | CC(C)=CCC/C(C)=C\CC/C(C)=C\CC/C=C(/C)CC/C=C(/C)CCCN(C)C |
| InChI | InChI=1S/C29H51N/c1-25(2)15-11-18-28(5)21-12-19-26(3)16-9-10-17-27(4)20-13-22-29(6)23-14-24-30(7)8/h15-17,21-22H,9-14,18-20,23-24H2,1-8H3/b26-16-,27-17-,28-21-,29-22- |
| InChIKey | OBYAAZRQFIVRJS-SSBIOBDKSA-N |
| XLogP | 9.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.73 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|