C31H55N — CID 6439792
(4Z,8Z,12Z,16Z)-N,N-diethyl-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaen-1-amine (PubChem CID 6439792) has the molecular formula C31H55N and a molecular weight of 441.79 g/mol. Its IUPAC name is (4Z,8Z,12Z,16Z)-N,N-diethyl-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaen-1-amine.
| Compound Name | (4Z,8Z,12Z,16Z)-N,N-diethyl-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaen-1-amine |
|---|---|
| PubChem CID | 6439792 |
| Molecular Formula | C31H55N |
| Molecular Weight | 441.79 g/mol |
| Exact Mass | 441.43 |
| IUPAC Name | (4Z,8Z,12Z,16Z)-N,N-diethyl-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaen-1-amine |
| SMILES | CCN(CC)CCC/C(C)=C\CC/C(C)=C\CC/C=C(/C)CC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C31H55N/c1-9-32(10-2)26-16-25-31(8)24-15-22-29(6)19-12-11-18-28(5)21-14-23-30(7)20-13-17-27(3)4/h17-19,23-24H,9-16,20-22,25-26H2,1-8H3/b28-18-,29-19-,30-23-,31-24- |
| InChIKey | DYTYGLWXXSHWDM-ALKIISATSA-N |
| XLogP | 9.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.79 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|