C24H37NO3 — CID 6439800
(2E,4E,6E,8E,10E,14E)-13-hydroxy-N-(1-hydroxypropan-2-yl)-2,10,12,14-tetramethylheptadeca-2,4,6,8,10,14-hexaenamide (PubChem CID 6439800) has the molecular formula C24H37NO3 and a molecular weight of 387.56 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,14E)-13-hydroxy-N-(1-hydroxypropan-2-yl)-2,10,12,14-tetramethylheptadeca-2,4,6,8,10,14-hexaenamide.
| Compound Name | (2E,4E,6E,8E,10E,14E)-13-hydroxy-N-(1-hydroxypropan-2-yl)-2,10,12,14-tetramethylheptadeca-2,4,6,8,10,14-hexaenamide |
|---|---|
| PubChem CID | 6439800 |
| Molecular Formula | C24H37NO3 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | (2E,4E,6E,8E,10E,14E)-13-hydroxy-N-(1-hydroxypropan-2-yl)-2,10,12,14-tetramethylheptadeca-2,4,6,8,10,14-hexaenamide |
| SMILES | CC/C=C(\C)C(O)C(C)/C=C(C)/C=C/C=C/C=C/C=C(\C)C(=O)NC(C)CO |
| InChI | InChI=1S/C24H37NO3/c1-7-13-19(3)23(27)21(5)16-18(2)14-11-9-8-10-12-15-20(4)24(28)25-22(6)17-26/h8-16,21-23,26-27H,7,17H2,1-6H3,(H,25,28)/b9-8+,12-10+,14-11+,18-16+,19-13+,20-15+ |
| InChIKey | QGJPEZISMDKYLK-IWMFOADDSA-N |
| XLogP | 4.40 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|