C19H27O10P — CID 6439824
[(1E,7E,9E,11E)-3,6,13-trihydroxy-1-(3-hydroxy-6-oxo-2,3-dihydropyran-2-yl)-3-methyltrideca-1,7,9,11-tetraen-4-yl] dihydrogen phosphate (PubChem CID 6439824) has the molecular formula C19H27O10P and a molecular weight of 446.39 g/mol. Its IUPAC name is [(1E,7E,9E,11E)-3,6,13-trihydroxy-1-(3-hydroxy-6-oxo-2,3-dihydropyran-2-yl)-3-methyltrideca-1,7,9,11-tetraen-4-yl] dihydrogen phosphate.
| Compound Name | [(1E,7E,9E,11E)-3,6,13-trihydroxy-1-(3-hydroxy-6-oxo-2,3-dihydropyran-2-yl)-3-methyltrideca-1,7,9,11-tetraen-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 6439824 |
| Molecular Formula | C19H27O10P |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | [(1E,7E,9E,11E)-3,6,13-trihydroxy-1-(3-hydroxy-6-oxo-2,3-dihydropyran-2-yl)-3-methyltrideca-1,7,9,11-tetraen-4-yl] dihydrogen phosphate |
| SMILES | CC(O)(/C=C/C1OC(=O)C=CC1O)C(CC(O)/C=C/C=C/C=C/CO)OP(=O)(O)O |
| InChI | InChI=1S/C19H27O10P/c1-19(24,11-10-16-15(22)8-9-18(23)28-16)17(29-30(25,26)27)13-14(21)7-5-3-2-4-6-12-20/h2-11,14-17,20-22,24H,12-13H2,1H3,(H2,25,26,27)/b3-2+,6-4+,7-5+,11-10+ |
| InChIKey | JIAYUFWCNLGCTK-IGICQAMHSA-N |
| XLogP | 0.03 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|