C17H16O4 — CID 6439876
5-[(E)-2-(2,2-dimethyl-1,3-benzodioxol-5-yl)ethenyl]benzene-1,3-diol (PubChem CID 6439876) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is 5-[(E)-2-(2,2-dimethyl-1,3-benzodioxol-5-yl)ethenyl]benzene-1,3-diol.
| Compound Name | 5-[(E)-2-(2,2-dimethyl-1,3-benzodioxol-5-yl)ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 6439876 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 5-[(E)-2-(2,2-dimethyl-1,3-benzodioxol-5-yl)ethenyl]benzene-1,3-diol |
| SMILES | CC1(C)Oc2ccc(/C=C/c3cc(O)cc(O)c3)cc2O1 |
| InChI | InChI=1S/C17H16O4/c1-17(2)20-15-6-5-11(9-16(15)21-17)3-4-12-7-13(18)10-14(19)8-12/h3-10,18-19H,1-2H3/b4-3+ |
| InChIKey | WDSMCLLELZZMDO-ONEGZZNKSA-N |
| XLogP | 3.78 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|