C15H27O4P — CID 6440220
[(2Z,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl] dihydrogen phosphate (PubChem CID 6440220) has the molecular formula C15H27O4P and a molecular weight of 302.35 g/mol. Its IUPAC name is [(2Z,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl] dihydrogen phosphate.
| Compound Name | [(2Z,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 6440220 |
| Molecular Formula | C15H27O4P |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | [(2Z,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl] dihydrogen phosphate |
| SMILES | CC(C)=CCC/C(C)=C\CC/C(C)=C\COP(=O)(O)O |
| InChI | InChI=1S/C15H27O4P/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-19-20(16,17)18/h7,9,11H,5-6,8,10,12H2,1-4H3,(H2,16,17,18)/b14-9-,15-11- |
| InChIKey | ALEWCKXBHSDCCT-FBXUGWQNSA-N |
| XLogP | 4.51 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|