About (E)-3-[2-(acridin-9-ylamino)phenyl]prop-2-enoic acid;hydrochloride
(E)-3-[2-(acridin-9-ylamino)phenyl]prop-2-enoic acid;hydrochloride (PubChem CID 6440245) has the molecular formula C22H17ClN2O2
and a molecular weight of 376.84 g/mol. Its IUPAC name is (E)-3-[2-(acridin-9-ylamino)phenyl]prop-2-enoic acid;hydrochloride.
Molecular Properties
| Compound Name | (E)-3-[2-(acridin-9-ylamino)phenyl]prop-2-enoic acid;hydrochloride |
| PubChem CID | 6440245 |
| Molecular Formula | C22H17ClN2O2 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | (E)-3-[2-(acridin-9-ylamino)phenyl]prop-2-enoic acid;hydrochloride |
| SMILES | Cl.O=C(O)/C=C/c1ccccc1Nc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C22H16N2O2.ClH/c25-21(26)14-13-15-7-1-4-10-18(15)24-22-16-8-2-5-11-19(16)23-20-12-6-3-9-17(20)22;/h1-14H,(H,23,24)(H,25,26);1H/b14-13+; |
| InChIKey | WUNUCBDNIKOOFV-IERUDJENSA-N |
| XLogP | 5.65 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[2-(acridin-9-ylamino)phenyl]prop-2-enoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[2-(acridin-9-ylamino)phenyl]prop-2-enoic acid;hydrochloride?
The IUPAC name of (E)-3-[2-(acridin-9-ylamino)phenyl]prop-2-enoic acid;hydrochloride (CID 6440245) is (E)-3-[2-(acridin-9-ylamino)phenyl]prop-2-enoic acid;hydrochloride.
What is the SMILES notation for (E)-3-[2-(acridin-9-ylamino)phenyl]prop-2-enoic acid;hydrochloride?
The canonical SMILES for (E)-3-[2-(acridin-9-ylamino)phenyl]prop-2-enoic acid;hydrochloride is Cl.O=C(O)/C=C/c1ccccc1Nc1c2ccccc2nc2ccccc12.
What is the InChIKey of (E)-3-[2-(acridin-9-ylamino)phenyl]prop-2-enoic acid;hydrochloride?
The InChIKey is WUNUCBDNIKOOFV-IERUDJENSA-N. The full InChI is InChI=1S/C22H16N2O2.ClH/c25-21(26)14-13-15-7-1-4-10-18(15)24-22-16-8-2-5-11-19(16)23-20-12-6-3-9-17(20)22;/h1-14H,(H,23,24)(H,25,26);1H/b14-13+;.
What are the key properties of (E)-3-[2-(acridin-9-ylamino)phenyl]prop-2-enoic acid;hydrochloride?
(E)-3-[2-(acridin-9-ylamino)phenyl]prop-2-enoic acid;hydrochloride has a molecular weight of 376.84 g/mol, XLogP of 5.65, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[2-(acridin-9-ylamino)phenyl]prop-2-enoic acid;hydrochloride is sourced from PubChem (CID 6440245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).