C12H16O2 — CID 6440355
(2Z,4Z,6Z,8Z)-10-hydroxydodeca-2,4,6,8-tetraenal (PubChem CID 6440355) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (2Z,4Z,6Z,8Z)-10-hydroxydodeca-2,4,6,8-tetraenal.
| Compound Name | (2Z,4Z,6Z,8Z)-10-hydroxydodeca-2,4,6,8-tetraenal |
|---|---|
| PubChem CID | 6440355 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (2Z,4Z,6Z,8Z)-10-hydroxydodeca-2,4,6,8-tetraenal |
| SMILES | CCC(O)/C=C\C=C/C=C\C=C/C=O |
| InChI | InChI=1S/C12H16O2/c1-2-12(14)10-8-6-4-3-5-7-9-11-13/h3-12,14H,2H2,1H3/b5-3-,6-4-,9-7-,10-8- |
| InChIKey | WEYIMDWLELIRAJ-RSIYVSQUSA-N |
| XLogP | 2.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|