C28H24O16S4 — CID 644084
25,26,27,28-tetrahydroxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,11,17,23-tetrasulfonic acid (PubChem CID 644084) has the molecular formula C28H24O16S4 and a molecular weight of 744.75 g/mol. Its IUPAC name is 25,26,27,28-tetrahydroxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,11,17,23-tetrasulfonic acid.
| Compound Name | 25,26,27,28-tetrahydroxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,11,17,23-tetrasulfonic acid |
|---|---|
| PubChem CID | 644084 |
| Molecular Formula | C28H24O16S4 |
| Molecular Weight | 744.75 g/mol |
| Exact Mass | 743.99 |
| IUPAC Name | 25,26,27,28-tetrahydroxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,11,17,23-tetrasulfonic acid |
| SMILES | O=S(=O)(O)c1cc2c(O)c(c1)Cc1cc(S(=O)(=O)O)cc(c1O)Cc1cc(S(=O)(=O)O)cc(c1O)Cc1cc(S(=O)(=O)O)cc(c1O)C2 |
| InChI | InChI=1S/C28H24O16S4/c29-25-13-1-14-6-22(46(36,37)38)8-16(26(14)30)3-18-10-24(48(42,43)44)12-20(28(18)32)4-19-11-23(47(39,40)41)9-17(27(19)31)2-15(25)7-21(5-13)45(33,34)35/h5-12,29-32H,1-4H2,(H,33,34,35)(H,36,37,38)(H,39,40,41)(H,42,43,44) |
| InChIKey | JFYBCAFLVNKHHG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 298.40 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.75 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|