About butan-2-one;(2E)-3,7-dimethylocta-2,6-dienal;methanol
butan-2-one;(2E)-3,7-dimethylocta-2,6-dienal;methanol (PubChem CID 6441131) has the molecular formula C15H28O3
and a molecular weight of 256.39 g/mol. Its IUPAC name is butan-2-one;(2E)-3,7-dimethylocta-2,6-dienal;methanol.
Molecular Properties
| Compound Name | butan-2-one;(2E)-3,7-dimethylocta-2,6-dienal;methanol |
| PubChem CID | 6441131 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | butan-2-one;(2E)-3,7-dimethylocta-2,6-dienal;methanol |
| SMILES | CC(C)=CCC/C(C)=C/C=O.CCC(C)=O.CO |
| InChI | InChI=1S/C10H16O.C4H8O.CH4O/c1-9(2)5-4-6-10(3)7-8-11;1-3-4(2)5;1-2/h5,7-8H,4,6H2,1-3H3;3H2,1-2H3;2H,1H3/b10-7+;; |
| InChIKey | FQPADWVIUAIQSH-WRQJSNHTSA-N |
| XLogP | 3.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butan-2-one;(2E)-3,7-dimethylocta-2,6-dienal;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;(2E)-3,7-dimethylocta-2,6-dienal;methanol?
The IUPAC name of butan-2-one;(2E)-3,7-dimethylocta-2,6-dienal;methanol (CID 6441131) is butan-2-one;(2E)-3,7-dimethylocta-2,6-dienal;methanol.
What is the SMILES notation for butan-2-one;(2E)-3,7-dimethylocta-2,6-dienal;methanol?
The canonical SMILES for butan-2-one;(2E)-3,7-dimethylocta-2,6-dienal;methanol is CC(C)=CCC/C(C)=C/C=O.CCC(C)=O.CO.
What is the InChIKey of butan-2-one;(2E)-3,7-dimethylocta-2,6-dienal;methanol?
The InChIKey is FQPADWVIUAIQSH-WRQJSNHTSA-N. The full InChI is InChI=1S/C10H16O.C4H8O.CH4O/c1-9(2)5-4-6-10(3)7-8-11;1-3-4(2)5;1-2/h5,7-8H,4,6H2,1-3H3;3H2,1-2H3;2H,1H3/b10-7+;;.
What are the key properties of butan-2-one;(2E)-3,7-dimethylocta-2,6-dienal;methanol?
butan-2-one;(2E)-3,7-dimethylocta-2,6-dienal;methanol has a molecular weight of 256.39 g/mol, XLogP of 3.47, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;(2E)-3,7-dimethylocta-2,6-dienal;methanol is sourced from PubChem (CID 6441131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).