C26H35N6O9P — CID 644117
N-[2-[hexyl-(4-nitrophenoxy)phosphoryl]oxyethyl]-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanamide (PubChem CID 644117) has the molecular formula C26H35N6O9P and a molecular weight of 606.57 g/mol. Its IUPAC name is N-[2-[hexyl-(4-nitrophenoxy)phosphoryl]oxyethyl]-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanamide.
| Compound Name | N-[2-[hexyl-(4-nitrophenoxy)phosphoryl]oxyethyl]-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanamide |
|---|---|
| PubChem CID | 644117 |
| Molecular Formula | C26H35N6O9P |
| Molecular Weight | 606.57 g/mol |
| Exact Mass | 606.22 |
| IUPAC Name | N-[2-[hexyl-(4-nitrophenoxy)phosphoryl]oxyethyl]-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanamide |
| SMILES | CCCCCCP(=O)(OCCNC(=O)CCCCCNc1ccc([N+](=O)[O-])c2nonc12)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H35N6O9P/c1-2-3-4-8-19-42(38,40-21-12-10-20(11-13-21)31(34)35)39-18-17-28-24(33)9-6-5-7-16-27-22-14-15-23(32(36)37)26-25(22)29-41-30-26/h10-15,27H,2-9,16-19H2,1H3,(H,28,33) |
| InChIKey | ZFHHVTNYROZCIO-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 201.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.57 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|