C33H51FeN6O12 — CID 6441418
iron(3+);(9Z,21Z,33Z)-3,15,27-triamino-10,22,34-trimethyl-7,19,31-trioxido-1,13,25-trioxa-7,19,31-triazacyclohexatriaconta-9,21,33-triene-2,8,14,20,26,32-hexone (PubChem CID 6441418) has the molecular formula C33H51FeN6O12 and a molecular weight of 779.65 g/mol. Its IUPAC name is iron(3+);(9Z,21Z,33Z)-3,15,27-triamino-10,22,34-trimethyl-7,19,31-trioxido-1,13,25-trioxa-7,19,31-triazacyclohexatriaconta-9,21,33-triene-2,8,14,20,26,32-hexone.
| Compound Name | iron(3+);(9Z,21Z,33Z)-3,15,27-triamino-10,22,34-trimethyl-7,19,31-trioxido-1,13,25-trioxa-7,19,31-triazacyclohexatriaconta-9,21,33-triene-2,8,14,20,26,32-hexone |
|---|---|
| PubChem CID | 6441418 |
| Molecular Formula | C33H51FeN6O12 |
| Molecular Weight | 779.65 g/mol |
| Exact Mass | 779.29 |
| IUPAC Name | iron(3+);(9Z,21Z,33Z)-3,15,27-triamino-10,22,34-trimethyl-7,19,31-trioxido-1,13,25-trioxa-7,19,31-triazacyclohexatriaconta-9,21,33-triene-2,8,14,20,26,32-hexone |
| SMILES | C/C1=C/C(=O)N([O-])CCCC(N)C(=O)OCC/C(C)=C\C(=O)N([O-])CCCC(N)C(=O)OCC/C(C)=C\C(=O)N([O-])CCCC(N)C(=O)OCC1.[Fe+3] |
| InChI | InChI=1S/C33H51N6O12.Fe/c1-22-10-16-49-31(43)25(34)8-5-14-38(47)29(41)20-24(3)12-18-51-33(45)27(36)9-6-15-39(48)30(42)21-23(2)11-17-50-32(44)26(35)7-4-13-37(46)28(40)19-22;/h19-21,25-27H,4-18,34-36H2,1-3H3;/q-3;+3/b22-19-,23-21-,24-20-; |
| InChIKey | KUQNHSOWVDQAOF-BBXZRSJSSA-N |
| XLogP | 0.94 |
| TPSA | 287.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.65 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|