C10H18 — CID 6441481
2-methylbut-2-ene;(3E)-penta-1,3-diene (PubChem CID 6441481) has the molecular formula C10H18 and a molecular weight of 138.25 g/mol. Its IUPAC name is 2-methylbut-2-ene;(3E)-penta-1,3-diene.
| Compound Name | 2-methylbut-2-ene;(3E)-penta-1,3-diene |
|---|---|
| PubChem CID | 6441481 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | 2-methylbut-2-ene;(3E)-penta-1,3-diene |
| SMILES | C=C/C=C/C.CC=C(C)C |
| InChI | InChI=1S/C5H10.C5H8/c1-4-5(2)3;1-3-5-4-2/h4H,1-3H3;3-5H,1H2,2H3/b;5-4+ |
| InChIKey | KLAJKQCMOYCTDK-RCKHEGBHSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|