About (E)-but-2-enedioic acid;bis(N,N-diethylethanamine)
(E)-but-2-enedioic acid;bis(N,N-diethylethanamine) (PubChem CID 6441493) has the molecular formula C16H34N2O4
and a molecular weight of 318.46 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;bis(N,N-diethylethanamine).
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;bis(N,N-diethylethanamine) |
| PubChem CID | 6441493 |
| Molecular Formula | C16H34N2O4 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | (E)-but-2-enedioic acid;bis(N,N-diethylethanamine) |
| SMILES | CCN(CC)CC.CCN(CC)CC.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/2C6H15N.C4H4O4/c2*1-4-7(5-2)6-3;5-3(6)1-2-4(7)8/h2*4-6H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChIKey | PNFDNSSZPUGEPI-WXXKFALUSA-N |
| XLogP | 2.41 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;bis(N,N-diethylethanamine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;bis(N,N-diethylethanamine)?
The IUPAC name of (E)-but-2-enedioic acid;bis(N,N-diethylethanamine) (CID 6441493) is (E)-but-2-enedioic acid;bis(N,N-diethylethanamine).
What is the SMILES notation for (E)-but-2-enedioic acid;bis(N,N-diethylethanamine)?
The canonical SMILES for (E)-but-2-enedioic acid;bis(N,N-diethylethanamine) is CCN(CC)CC.CCN(CC)CC.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (E)-but-2-enedioic acid;bis(N,N-diethylethanamine)?
The InChIKey is PNFDNSSZPUGEPI-WXXKFALUSA-N. The full InChI is InChI=1S/2C6H15N.C4H4O4/c2*1-4-7(5-2)6-3;5-3(6)1-2-4(7)8/h2*4-6H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;;2-1+.
What are the key properties of (E)-but-2-enedioic acid;bis(N,N-diethylethanamine)?
(E)-but-2-enedioic acid;bis(N,N-diethylethanamine) has a molecular weight of 318.46 g/mol, XLogP of 2.41, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;bis(N,N-diethylethanamine) is sourced from PubChem (CID 6441493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).