About 1-(2-hydroxypropylamino)propan-2-ol;(Z)-octadec-9-enoic acid
1-(2-hydroxypropylamino)propan-2-ol;(Z)-octadec-9-enoic acid (PubChem CID 6441596) has the molecular formula C24H49NO4
and a molecular weight of 415.66 g/mol. Its IUPAC name is 1-(2-hydroxypropylamino)propan-2-ol;(Z)-octadec-9-enoic acid.
Molecular Properties
| Compound Name | 1-(2-hydroxypropylamino)propan-2-ol;(Z)-octadec-9-enoic acid |
| PubChem CID | 6441596 |
| Molecular Formula | C24H49NO4 |
| Molecular Weight | 415.66 g/mol |
| Exact Mass | 415.37 |
| IUPAC Name | 1-(2-hydroxypropylamino)propan-2-ol;(Z)-octadec-9-enoic acid |
| SMILES | CC(O)CNCC(C)O.CCCCCCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O2.C6H15NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-5(8)3-7-4-6(2)9/h9-10H,2-8,11-17H2,1H3,(H,19,20);5-9H,3-4H2,1-2H3/b10-9-; |
| InChIKey | QZNJFNVUPYDXHR-KVVVOXFISA-N |
| XLogP | 5.45 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.66 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hydroxypropylamino)propan-2-ol;(Z)-octadec-9-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxypropylamino)propan-2-ol;(Z)-octadec-9-enoic acid?
The IUPAC name of 1-(2-hydroxypropylamino)propan-2-ol;(Z)-octadec-9-enoic acid (CID 6441596) is 1-(2-hydroxypropylamino)propan-2-ol;(Z)-octadec-9-enoic acid.
What is the SMILES notation for 1-(2-hydroxypropylamino)propan-2-ol;(Z)-octadec-9-enoic acid?
The canonical SMILES for 1-(2-hydroxypropylamino)propan-2-ol;(Z)-octadec-9-enoic acid is CC(O)CNCC(C)O.CCCCCCCC/C=C\CCCCCCCC(=O)O.
What is the InChIKey of 1-(2-hydroxypropylamino)propan-2-ol;(Z)-octadec-9-enoic acid?
The InChIKey is QZNJFNVUPYDXHR-KVVVOXFISA-N. The full InChI is InChI=1S/C18H34O2.C6H15NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-5(8)3-7-4-6(2)9/h9-10H,2-8,11-17H2,1H3,(H,19,20);5-9H,3-4H2,1-2H3/b10-9-;.
What are the key properties of 1-(2-hydroxypropylamino)propan-2-ol;(Z)-octadec-9-enoic acid?
1-(2-hydroxypropylamino)propan-2-ol;(Z)-octadec-9-enoic acid has a molecular weight of 415.66 g/mol, XLogP of 5.45, 19 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxypropylamino)propan-2-ol;(Z)-octadec-9-enoic acid is sourced from PubChem (CID 6441596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).