About 2-ethylhexyl (9Z,12Z)-octadeca-9,12-dienoate
2-ethylhexyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 6441653) has the molecular formula C26H48O2
and a molecular weight of 392.67 g/mol. Its IUPAC name is 2-ethylhexyl (9Z,12Z)-octadeca-9,12-dienoate.
Molecular Properties
| Compound Name | 2-ethylhexyl (9Z,12Z)-octadeca-9,12-dienoate |
| PubChem CID | 6441653 |
| Molecular Formula | C26H48O2 |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 392.37 |
| IUPAC Name | 2-ethylhexyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C26H48O2/c1-4-7-9-10-11-12-13-14-15-16-17-18-19-20-21-23-26(27)28-24-25(6-3)22-8-5-2/h11-12,14-15,25H,4-10,13,16-24H2,1-3H3/b12-11-,15-14- |
| InChIKey | PSAAPHZQPIWZFX-HDXUUTQWSA-N |
| XLogP | 8.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexyl (9Z,12Z)-octadeca-9,12-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl (9Z,12Z)-octadeca-9,12-dienoate?
The IUPAC name of 2-ethylhexyl (9Z,12Z)-octadeca-9,12-dienoate (CID 6441653) is 2-ethylhexyl (9Z,12Z)-octadeca-9,12-dienoate.
What is the SMILES notation for 2-ethylhexyl (9Z,12Z)-octadeca-9,12-dienoate?
The canonical SMILES for 2-ethylhexyl (9Z,12Z)-octadeca-9,12-dienoate is CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(CC)CCCC.
What is the InChIKey of 2-ethylhexyl (9Z,12Z)-octadeca-9,12-dienoate?
The InChIKey is PSAAPHZQPIWZFX-HDXUUTQWSA-N. The full InChI is InChI=1S/C26H48O2/c1-4-7-9-10-11-12-13-14-15-16-17-18-19-20-21-23-26(27)28-24-25(6-3)22-8-5-2/h11-12,14-15,25H,4-10,13,16-24H2,1-3H3/b12-11-,15-14-.
What are the key properties of 2-ethylhexyl (9Z,12Z)-octadeca-9,12-dienoate?
2-ethylhexyl (9Z,12Z)-octadeca-9,12-dienoate has a molecular weight of 392.67 g/mol, XLogP of 8.56, 20 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl (9Z,12Z)-octadeca-9,12-dienoate is sourced from PubChem (CID 6441653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).