2-(2-aminoethylamino)ethanol;(Z)-octadec-9-enoic acid

C22H46N2O3 — CID 6441827

IUPAC2-(2-aminoethylamino)ethanol;(Z)-octadec-9-enoic acid
SMILESCCCCCCCC/C=C\CCCCCCCC(=O)O.NCCNCCO
InChIInChI=1S/C18H34O2.C4H12N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-2-6-3-4-7/h9-10H,2-8,11-17H2,1H3,(H,19,20);6-7H,1-5H2/b10-9-;
InChIKeyYGJDXOJIYODGEO-KVVVOXFISA-N
MW386.62 g/mol
LogP4.64
Rot. Bonds19

About 2-(2-aminoethylamino)ethanol;(Z)-octadec-9-enoic acid

2-(2-aminoethylamino)ethanol;(Z)-octadec-9-enoic acid (PubChem CID 6441827) has the molecular formula C22H46N2O3 and a molecular weight of 386.62 g/mol. Its IUPAC name is 2-(2-aminoethylamino)ethanol;(Z)-octadec-9-enoic acid.

Molecular Properties

Compound Name2-(2-aminoethylamino)ethanol;(Z)-octadec-9-enoic acid
PubChem CID6441827
Molecular FormulaC22H46N2O3
Molecular Weight386.62 g/mol
Exact Mass386.35
IUPAC Name2-(2-aminoethylamino)ethanol;(Z)-octadec-9-enoic acid
SMILESCCCCCCCC/C=C\CCCCCCCC(=O)O.NCCNCCO
InChIInChI=1S/C18H34O2.C4H12N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-2-6-3-4-7/h9-10H,2-8,11-17H2,1H3,(H,19,20);6-7H,1-5H2/b10-9-;
InChIKeyYGJDXOJIYODGEO-KVVVOXFISA-N
XLogP4.64
TPSA95.58 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds19
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500386.62
LogP ≤ 54.64
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-(2-aminoethylamino)ethanol;(Z)-octadec-9-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-aminoethylamino)ethanol;(Z)-octadec-9-enoic acid?
The IUPAC name of 2-(2-aminoethylamino)ethanol;(Z)-octadec-9-enoic acid (CID 6441827) is 2-(2-aminoethylamino)ethanol;(Z)-octadec-9-enoic acid.
What is the SMILES notation for 2-(2-aminoethylamino)ethanol;(Z)-octadec-9-enoic acid?
The canonical SMILES for 2-(2-aminoethylamino)ethanol;(Z)-octadec-9-enoic acid is CCCCCCCC/C=C\CCCCCCCC(=O)O.NCCNCCO.
What is the InChIKey of 2-(2-aminoethylamino)ethanol;(Z)-octadec-9-enoic acid?
The InChIKey is YGJDXOJIYODGEO-KVVVOXFISA-N. The full InChI is InChI=1S/C18H34O2.C4H12N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-2-6-3-4-7/h9-10H,2-8,11-17H2,1H3,(H,19,20);6-7H,1-5H2/b10-9-;.
What are the key properties of 2-(2-aminoethylamino)ethanol;(Z)-octadec-9-enoic acid?
2-(2-aminoethylamino)ethanol;(Z)-octadec-9-enoic acid has a molecular weight of 386.62 g/mol, XLogP of 4.64, 19 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethylamino)ethanol;(Z)-octadec-9-enoic acid is sourced from PubChem (CID 6441827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).