C13H22O — CID 6441956
(6E)-2,4,4,7-tetramethylnona-6,8-dien-3-one (PubChem CID 6441956) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is (6E)-2,4,4,7-tetramethylnona-6,8-dien-3-one.
| Compound Name | (6E)-2,4,4,7-tetramethylnona-6,8-dien-3-one |
|---|---|
| PubChem CID | 6441956 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (6E)-2,4,4,7-tetramethylnona-6,8-dien-3-one |
| SMILES | C=C/C(C)=C/CC(C)(C)C(=O)C(C)C |
| InChI | InChI=1S/C13H22O/c1-7-11(4)8-9-13(5,6)12(14)10(2)3/h7-8,10H,1,9H2,2-6H3/b11-8+ |
| InChIKey | TWJFINAHYOYYOB-DHZHZOJOSA-N |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|